C11H18N2O5 — CID 174918850
3,4-dinitro-2-pentylcyclohexan-1-one (PubChem CID 174918850) has the molecular formula C11H18N2O5 and a molecular weight of 258.27 g/mol. Its IUPAC name is 3,4-dinitro-2-pentylcyclohexan-1-one.
| Compound Name | 3,4-dinitro-2-pentylcyclohexan-1-one |
|---|---|
| PubChem CID | 174918850 |
| Molecular Formula | C11H18N2O5 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 3,4-dinitro-2-pentylcyclohexan-1-one |
| SMILES | CCCCCC1C(=O)CCC([N+](=O)[O-])C1[N+](=O)[O-] |
| InChI | InChI=1S/C11H18N2O5/c1-2-3-4-5-8-10(14)7-6-9(12(15)16)11(8)13(17)18/h8-9,11H,2-7H2,1H3 |
| InChIKey | KRKBYMHBEILWSL-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|