C19H34N2O4 — CID 174920951
4,5-dihydro-1H-imidazole;2-dodec-1-enylbutanedioic acid (PubChem CID 174920951) has the molecular formula C19H34N2O4 and a molecular weight of 354.49 g/mol. Its IUPAC name is 4,5-dihydro-1H-imidazole;2-dodec-1-enylbutanedioic acid.
| Compound Name | 4,5-dihydro-1H-imidazole;2-dodec-1-enylbutanedioic acid |
|---|---|
| PubChem CID | 174920951 |
| Molecular Formula | C19H34N2O4 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.25 |
| IUPAC Name | 4,5-dihydro-1H-imidazole;2-dodec-1-enylbutanedioic acid |
| SMILES | C1=NCCN1.CCCCCCCCCCC=CC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C16H28O4.C3H6N2/c1-2-3-4-5-6-7-8-9-10-11-12-14(16(19)20)13-15(17)18;1-2-5-3-4-1/h11-12,14H,2-10,13H2,1H3,(H,17,18)(H,19,20);3H,1-2H2,(H,4,5) |
| InChIKey | DTHDMRCUENHYSO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|