About amino 5-phosphorosopentanoate;pentanoic acid
amino 5-phosphorosopentanoate;pentanoic acid (PubChem CID 174921550) has the molecular formula C10H20NO5P
and a molecular weight of 265.25 g/mol. Its IUPAC name is amino 5-phosphorosopentanoate;pentanoic acid.
Molecular Properties
| Compound Name | amino 5-phosphorosopentanoate;pentanoic acid |
| PubChem CID | 174921550 |
| Molecular Formula | C10H20NO5P |
| Molecular Weight | 265.25 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | amino 5-phosphorosopentanoate;pentanoic acid |
| SMILES | CCCCC(=O)O.NOC(=O)CCCCP=O |
| InChI | InChI=1S/C5H10NO3P.C5H10O2/c6-9-5(7)3-1-2-4-10-8;1-2-3-4-5(6)7/h1-4,6H2;2-4H2,1H3,(H,6,7) |
| InChIKey | JEESDKSAQFJKRB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.25 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze amino 5-phosphorosopentanoate;pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino 5-phosphorosopentanoate;pentanoic acid?
The IUPAC name of amino 5-phosphorosopentanoate;pentanoic acid (CID 174921550) is amino 5-phosphorosopentanoate;pentanoic acid.
What is the SMILES notation for amino 5-phosphorosopentanoate;pentanoic acid?
The canonical SMILES for amino 5-phosphorosopentanoate;pentanoic acid is CCCCC(=O)O.NOC(=O)CCCCP=O.
What is the InChIKey of amino 5-phosphorosopentanoate;pentanoic acid?
The InChIKey is JEESDKSAQFJKRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10NO3P.C5H10O2/c6-9-5(7)3-1-2-4-10-8;1-2-3-4-5(6)7/h1-4,6H2;2-4H2,1H3,(H,6,7).
What are the key properties of amino 5-phosphorosopentanoate;pentanoic acid?
amino 5-phosphorosopentanoate;pentanoic acid has a molecular weight of 265.25 g/mol, XLogP of 2.13, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for amino 5-phosphorosopentanoate;pentanoic acid is sourced from PubChem (CID 174921550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).