C17H16N2O2 — CID 174922883
3-benzyl-4-ethenylbenzene-1,2-dicarboxamide (PubChem CID 174922883) has the molecular formula C17H16N2O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is 3-benzyl-4-ethenylbenzene-1,2-dicarboxamide.
| Compound Name | 3-benzyl-4-ethenylbenzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 174922883 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 3-benzyl-4-ethenylbenzene-1,2-dicarboxamide |
| SMILES | C=Cc1ccc(C(N)=O)c(C(N)=O)c1Cc1ccccc1 |
| InChI | InChI=1S/C17H16N2O2/c1-2-12-8-9-13(16(18)20)15(17(19)21)14(12)10-11-6-4-3-5-7-11/h2-9H,1,10H2,(H2,18,20)(H2,19,21) |
| InChIKey | FAQLTLRCZGDTQJ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |