About 5-benzyl-2-ethenylbenzoyl chloride;ethane
5-benzyl-2-ethenylbenzoyl chloride;ethane (PubChem CID 91515682) has the molecular formula C18H19ClO
and a molecular weight of 286.80 g/mol. Its IUPAC name is 5-benzyl-2-ethenylbenzoyl chloride;ethane.
Molecular Properties
| Compound Name | 5-benzyl-2-ethenylbenzoyl chloride;ethane |
| PubChem CID | 91515682 |
| Molecular Formula | C18H19ClO |
| Molecular Weight | 286.80 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 5-benzyl-2-ethenylbenzoyl chloride;ethane |
| SMILES | C=Cc1ccc(Cc2ccccc2)cc1C(=O)Cl.CC |
| InChI | InChI=1S/C16H13ClO.C2H6/c1-2-14-9-8-13(11-15(14)16(17)18)10-12-6-4-3-5-7-12;1-2/h2-9,11H,1,10H2;1-2H3 |
| InChIKey | FENNLRSJAFCFAU-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.80 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-benzyl-2-ethenylbenzoyl chloride;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzyl-2-ethenylbenzoyl chloride;ethane?
The IUPAC name of 5-benzyl-2-ethenylbenzoyl chloride;ethane (CID 91515682) is 5-benzyl-2-ethenylbenzoyl chloride;ethane.
What is the SMILES notation for 5-benzyl-2-ethenylbenzoyl chloride;ethane?
The canonical SMILES for 5-benzyl-2-ethenylbenzoyl chloride;ethane is C=Cc1ccc(Cc2ccccc2)cc1C(=O)Cl.CC.
What is the InChIKey of 5-benzyl-2-ethenylbenzoyl chloride;ethane?
The InChIKey is FENNLRSJAFCFAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13ClO.C2H6/c1-2-14-9-8-13(11-15(14)16(17)18)10-12-6-4-3-5-7-12;1-2/h2-9,11H,1,10H2;1-2H3.
What are the key properties of 5-benzyl-2-ethenylbenzoyl chloride;ethane?
5-benzyl-2-ethenylbenzoyl chloride;ethane has a molecular weight of 286.80 g/mol, XLogP of 5.33, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyl-2-ethenylbenzoyl chloride;ethane is sourced from PubChem (CID 91515682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).