C9H12BrN5O2 — CID 174925660
2-[(4-nitrophenyl)methyl]-3H-1,2,4-triazol-4-amine;hydrobromide (PubChem CID 174925660) has the molecular formula C9H12BrN5O2 and a molecular weight of 302.13 g/mol. Its IUPAC name is 2-[(4-nitrophenyl)methyl]-3H-1,2,4-triazol-4-amine;hydrobromide.
| Compound Name | 2-[(4-nitrophenyl)methyl]-3H-1,2,4-triazol-4-amine;hydrobromide |
|---|---|
| PubChem CID | 174925660 |
| Molecular Formula | C9H12BrN5O2 |
| Molecular Weight | 302.13 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 2-[(4-nitrophenyl)methyl]-3H-1,2,4-triazol-4-amine;hydrobromide |
| SMILES | Br.NN1C=NN(Cc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C9H11N5O2.BrH/c10-12-6-11-13(7-12)5-8-1-3-9(4-2-8)14(15)16;/h1-4,6H,5,7,10H2;1H |
| InChIKey | JHXNYKBTRHDHMV-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.13 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|