2,2-dimethylpropoxy(ethoxy)borinic acid;ethane-1,2-diol

C9H23BO5 — CID 174928283

IUPAC2,2-dimethylpropoxy(ethoxy)borinic acid;ethane-1,2-diol
SMILESCCOB(O)OCC(C)(C)C.OCCO
InChIInChI=1S/C7H17BO3.C2H6O2/c1-5-10-8(9)11-6-7(2,3)4;3-1-2-4/h9H,5-6H2,1-4H3;3-4H,1-2H2
InChIKeyBDPYHAIZEMWACR-UHFFFAOYSA-N
MW222.09 g/mol
LogP0.03
Rot. Bonds5

About 2,2-dimethylpropoxy(ethoxy)borinic acid;ethane-1,2-diol

2,2-dimethylpropoxy(ethoxy)borinic acid;ethane-1,2-diol (PubChem CID 174928283) has the molecular formula C9H23BO5 and a molecular weight of 222.09 g/mol. Its IUPAC name is 2,2-dimethylpropoxy(ethoxy)borinic acid;ethane-1,2-diol.

Molecular Properties

Compound Name2,2-dimethylpropoxy(ethoxy)borinic acid;ethane-1,2-diol
PubChem CID174928283
Molecular FormulaC9H23BO5
Molecular Weight222.09 g/mol
Exact Mass222.16
IUPAC Name2,2-dimethylpropoxy(ethoxy)borinic acid;ethane-1,2-diol
SMILESCCOB(O)OCC(C)(C)C.OCCO
InChIInChI=1S/C7H17BO3.C2H6O2/c1-5-10-8(9)11-6-7(2,3)4;3-1-2-4/h9H,5-6H2,1-4H3;3-4H,1-2H2
InChIKeyBDPYHAIZEMWACR-UHFFFAOYSA-N
XLogP0.03
TPSA79.15 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500222.09
LogP ≤ 50.03
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze 2,2-dimethylpropoxy(ethoxy)borinic acid;ethane-1,2-diol with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-dimethylpropoxy(ethoxy)borinic acid;ethane-1,2-diol?
The IUPAC name of 2,2-dimethylpropoxy(ethoxy)borinic acid;ethane-1,2-diol (CID 174928283) is 2,2-dimethylpropoxy(ethoxy)borinic acid;ethane-1,2-diol.
What is the SMILES notation for 2,2-dimethylpropoxy(ethoxy)borinic acid;ethane-1,2-diol?
The canonical SMILES for 2,2-dimethylpropoxy(ethoxy)borinic acid;ethane-1,2-diol is CCOB(O)OCC(C)(C)C.OCCO.
What is the InChIKey of 2,2-dimethylpropoxy(ethoxy)borinic acid;ethane-1,2-diol?
The InChIKey is BDPYHAIZEMWACR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17BO3.C2H6O2/c1-5-10-8(9)11-6-7(2,3)4;3-1-2-4/h9H,5-6H2,1-4H3;3-4H,1-2H2.
What are the key properties of 2,2-dimethylpropoxy(ethoxy)borinic acid;ethane-1,2-diol?
2,2-dimethylpropoxy(ethoxy)borinic acid;ethane-1,2-diol has a molecular weight of 222.09 g/mol, XLogP of 0.03, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylpropoxy(ethoxy)borinic acid;ethane-1,2-diol is sourced from PubChem (CID 174928283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).