C20H21FN2O2S — CID 17492839
(E)-1-[4-(4-acetyl-2-fluorophenyl)piperazin-1-yl]-3-(3-methylthiophen-2-yl)prop-2-en-1-one (PubChem CID 17492839) has the molecular formula C20H21FN2O2S and a molecular weight of 372.47 g/mol. Its IUPAC name is (E)-1-[4-(4-acetyl-2-fluorophenyl)piperazin-1-yl]-3-(3-methylthiophen-2-yl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(4-acetyl-2-fluorophenyl)piperazin-1-yl]-3-(3-methylthiophen-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 17492839 |
| Molecular Formula | C20H21FN2O2S |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | (E)-1-[4-(4-acetyl-2-fluorophenyl)piperazin-1-yl]-3-(3-methylthiophen-2-yl)prop-2-en-1-one |
| SMILES | CC(=O)c1ccc(N2CCN(C(=O)/C=C/c3sccc3C)CC2)c(F)c1 |
| InChI | InChI=1S/C20H21FN2O2S/c1-14-7-12-26-19(14)5-6-20(25)23-10-8-22(9-11-23)18-4-3-16(15(2)24)13-17(18)21/h3-7,12-13H,8-11H2,1-2H3/b6-5+ |
| InChIKey | JCUJHUDIFBCNNK-AATRIKPKSA-N |
| XLogP | 3.76 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|