About 3-pyridin-3-yl-1,5-naphthyridine-2,7-diamine
3-pyridin-3-yl-1,5-naphthyridine-2,7-diamine (PubChem CID 174929269) has the molecular formula C13H11N5
and a molecular weight of 237.27 g/mol. Its IUPAC name is 3-pyridin-3-yl-1,5-naphthyridine-2,7-diamine.
Molecular Properties
| Compound Name | 3-pyridin-3-yl-1,5-naphthyridine-2,7-diamine |
| PubChem CID | 174929269 |
| Molecular Formula | C13H11N5 |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 3-pyridin-3-yl-1,5-naphthyridine-2,7-diamine |
| SMILES | Nc1cnc2cc(-c3cccnc3)c(N)nc2c1 |
| InChI | InChI=1S/C13H11N5/c14-9-4-12-11(17-7-9)5-10(13(15)18-12)8-2-1-3-16-6-8/h1-7H,14H2,(H2,15,18) |
| InChIKey | PRPKIKCRLFFRNO-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-pyridin-3-yl-1,5-naphthyridine-2,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyridin-3-yl-1,5-naphthyridine-2,7-diamine?
The IUPAC name of 3-pyridin-3-yl-1,5-naphthyridine-2,7-diamine (CID 174929269) is 3-pyridin-3-yl-1,5-naphthyridine-2,7-diamine.
What is the SMILES notation for 3-pyridin-3-yl-1,5-naphthyridine-2,7-diamine?
The canonical SMILES for 3-pyridin-3-yl-1,5-naphthyridine-2,7-diamine is Nc1cnc2cc(-c3cccnc3)c(N)nc2c1.
What is the InChIKey of 3-pyridin-3-yl-1,5-naphthyridine-2,7-diamine?
The InChIKey is PRPKIKCRLFFRNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N5/c14-9-4-12-11(17-7-9)5-10(13(15)18-12)8-2-1-3-16-6-8/h1-7H,14H2,(H2,15,18).
What are the key properties of 3-pyridin-3-yl-1,5-naphthyridine-2,7-diamine?
3-pyridin-3-yl-1,5-naphthyridine-2,7-diamine has a molecular weight of 237.27 g/mol, XLogP of 1.86, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyridin-3-yl-1,5-naphthyridine-2,7-diamine is sourced from PubChem (CID 174929269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).