C22H42NO3P — CID 174930070
(9Z,12Z)-octadeca-9,12-dienoic acid;phosphane;pyrrolidin-2-one (PubChem CID 174930070) has the molecular formula C22H42NO3P and a molecular weight of 399.56 g/mol. Its IUPAC name is (9Z,12Z)-octadeca-9,12-dienoic acid;phosphane;pyrrolidin-2-one.
| Compound Name | (9Z,12Z)-octadeca-9,12-dienoic acid;phosphane;pyrrolidin-2-one |
|---|---|
| PubChem CID | 174930070 |
| Molecular Formula | C22H42NO3P |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.29 |
| IUPAC Name | (9Z,12Z)-octadeca-9,12-dienoic acid;phosphane;pyrrolidin-2-one |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)O.O=C1CCCN1.P |
| InChI | InChI=1S/C18H32O2.C4H7NO.H3P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;6-4-2-1-3-5-4;/h6-7,9-10H,2-5,8,11-17H2,1H3,(H,19,20);1-3H2,(H,5,6);1H3/b7-6-,10-9-;; |
| InChIKey | ZCBNHOAJTYWXLS-JFHYDWJLSA-N |
| XLogP | 5.84 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|