About octadecanoic acid;pyrrolidin-2-one;zinc
octadecanoic acid;pyrrolidin-2-one;zinc (PubChem CID 67236635) has the molecular formula C22H43NO3Zn
and a molecular weight of 434.98 g/mol. Its IUPAC name is octadecanoic acid;pyrrolidin-2-one;zinc.
Molecular Properties
| Compound Name | octadecanoic acid;pyrrolidin-2-one;zinc |
| PubChem CID | 67236635 |
| Molecular Formula | C22H43NO3Zn |
| Molecular Weight | 434.98 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | octadecanoic acid;pyrrolidin-2-one;zinc |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)O.O=C1CCCN1.[Zn] |
| InChI | InChI=1S/C18H36O2.C4H7NO.Zn/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;6-4-2-1-3-5-4;/h2-17H2,1H3,(H,19,20);1-3H2,(H,5,6); |
| InChIKey | SHXLQNWCEBZRCK-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.98 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze octadecanoic acid;pyrrolidin-2-one;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octadecanoic acid;pyrrolidin-2-one;zinc?
The IUPAC name of octadecanoic acid;pyrrolidin-2-one;zinc (CID 67236635) is octadecanoic acid;pyrrolidin-2-one;zinc.
What is the SMILES notation for octadecanoic acid;pyrrolidin-2-one;zinc?
The canonical SMILES for octadecanoic acid;pyrrolidin-2-one;zinc is CCCCCCCCCCCCCCCCCC(=O)O.O=C1CCCN1.[Zn].
What is the InChIKey of octadecanoic acid;pyrrolidin-2-one;zinc?
The InChIKey is SHXLQNWCEBZRCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O2.C4H7NO.Zn/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;6-4-2-1-3-5-4;/h2-17H2,1H3,(H,19,20);1-3H2,(H,5,6);.
What are the key properties of octadecanoic acid;pyrrolidin-2-one;zinc?
octadecanoic acid;pyrrolidin-2-one;zinc has a molecular weight of 434.98 g/mol, XLogP of 6.23, 16 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for octadecanoic acid;pyrrolidin-2-one;zinc is sourced from PubChem (CID 67236635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).