C8H10O9 — CID 174930883
2-acetylperoxypropane-1,2,3-tricarboxylic acid (PubChem CID 174930883) has the molecular formula C8H10O9 and a molecular weight of 250.16 g/mol. Its IUPAC name is 2-acetylperoxypropane-1,2,3-tricarboxylic acid.
| Compound Name | 2-acetylperoxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 174930883 |
| Molecular Formula | C8H10O9 |
| Molecular Weight | 250.16 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 2-acetylperoxypropane-1,2,3-tricarboxylic acid |
| SMILES | CC(=O)OOC(CC(=O)O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H10O9/c1-4(9)16-17-8(7(14)15,2-5(10)11)3-6(12)13/h2-3H2,1H3,(H,10,11)(H,12,13)(H,14,15) |
| InChIKey | XGMCCDSUUQXUGF-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.16 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|