C23H41N4O5P — CID 174932119
(2R,6S)-2,6-dimethyl-4-[2-methyl-3-[4-(2-methylbutan-2-yl)phenyl]propyl]morpholine;phosphoric acid;2H-triazole (PubChem CID 174932119) has the molecular formula C23H41N4O5P and a molecular weight of 484.58 g/mol. Its IUPAC name is (2R,6S)-2,6-dimethyl-4-[2-methyl-3-[4-(2-methylbutan-2-yl)phenyl]propyl]morpholine;phosphoric acid;2H-triazole.
| Compound Name | (2R,6S)-2,6-dimethyl-4-[2-methyl-3-[4-(2-methylbutan-2-yl)phenyl]propyl]morpholine;phosphoric acid;2H-triazole |
|---|---|
| PubChem CID | 174932119 |
| Molecular Formula | C23H41N4O5P |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | (2R,6S)-2,6-dimethyl-4-[2-methyl-3-[4-(2-methylbutan-2-yl)phenyl]propyl]morpholine;phosphoric acid;2H-triazole |
| SMILES | CCC(C)(C)c1ccc(CC(C)CN2C[C@@H](C)O[C@@H](C)C2)cc1.O=P(O)(O)O.c1cn[nH]n1 |
| InChI | InChI=1S/C21H35NO.C2H3N3.H3O4P/c1-7-21(5,6)20-10-8-19(9-11-20)12-16(2)13-22-14-17(3)23-18(4)15-22;1-2-4-5-3-1;1-5(2,3)4/h8-11,16-18H,7,12-15H2,1-6H3;1-2H,(H,3,4,5);(H3,1,2,3,4)/t16?,17-,18+;; |
| InChIKey | HILONXMLPPTXLO-BALQKLRMSA-N |
| XLogP | 3.54 |
| TPSA | 131.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|