C20H31NO — CID 163798698
(2S)-4-[3-(4-tert-butylphenyl)-2-methylpropyl]-2-methyl-6-methylidenemorpholine (PubChem CID 163798698) has the molecular formula C20H31NO and a molecular weight of 301.47 g/mol. Its IUPAC name is (2S)-4-[3-(4-tert-butylphenyl)-2-methylpropyl]-2-methyl-6-methylidenemorpholine.
| Compound Name | (2S)-4-[3-(4-tert-butylphenyl)-2-methylpropyl]-2-methyl-6-methylidenemorpholine |
|---|---|
| PubChem CID | 163798698 |
| Molecular Formula | C20H31NO |
| Molecular Weight | 301.47 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | (2S)-4-[3-(4-tert-butylphenyl)-2-methylpropyl]-2-methyl-6-methylidenemorpholine |
| SMILES | C=C1CN(CC(C)Cc2ccc(C(C)(C)C)cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C20H31NO/c1-15(12-21-13-16(2)22-17(3)14-21)11-18-7-9-19(10-8-18)20(4,5)6/h7-10,15,17H,2,11-14H2,1,3-6H3/t15?,17-/m0/s1 |
| InChIKey | NDBJIZMHTBIDJO-LWKPJOBUSA-N |
| XLogP | 4.40 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.47 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |