C11H12Br2N2O — CID 174935031
2-(2,4-dibromophenyl)-3-(dimethylamino)prop-2-enamide (PubChem CID 174935031) has the molecular formula C11H12Br2N2O and a molecular weight of 348.04 g/mol. Its IUPAC name is 2-(2,4-dibromophenyl)-3-(dimethylamino)prop-2-enamide.
| Compound Name | 2-(2,4-dibromophenyl)-3-(dimethylamino)prop-2-enamide |
|---|---|
| PubChem CID | 174935031 |
| Molecular Formula | C11H12Br2N2O |
| Molecular Weight | 348.04 g/mol |
| Exact Mass | 345.93 |
| IUPAC Name | 2-(2,4-dibromophenyl)-3-(dimethylamino)prop-2-enamide |
| SMILES | CN(C)C=C(C(N)=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C11H12Br2N2O/c1-15(2)6-9(11(14)16)8-4-3-7(12)5-10(8)13/h3-6H,1-2H3,(H2,14,16) |
| InChIKey | MFEFZNHKGDBIGJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.04 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|