About N,N-diethylethanamine;5-(trifluoromethyl)thiophene-2-carboxylic acid
N,N-diethylethanamine;5-(trifluoromethyl)thiophene-2-carboxylic acid (PubChem CID 174935437) has the molecular formula C12H18F3NO2S
and a molecular weight of 297.34 g/mol. Its IUPAC name is N,N-diethylethanamine;5-(trifluoromethyl)thiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | N,N-diethylethanamine;5-(trifluoromethyl)thiophene-2-carboxylic acid |
| PubChem CID | 174935437 |
| Molecular Formula | C12H18F3NO2S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | N,N-diethylethanamine;5-(trifluoromethyl)thiophene-2-carboxylic acid |
| SMILES | CCN(CC)CC.O=C(O)c1ccc(C(F)(F)F)s1 |
| InChI | InChI=1S/C6H3F3O2S.C6H15N/c7-6(8,9)4-2-1-3(12-4)5(10)11;1-4-7(5-2)6-3/h1-2H,(H,10,11);4-6H2,1-3H3 |
| InChIKey | BBMFWKOLKXRJQT-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-diethylethanamine;5-(trifluoromethyl)thiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylethanamine;5-(trifluoromethyl)thiophene-2-carboxylic acid?
The IUPAC name of N,N-diethylethanamine;5-(trifluoromethyl)thiophene-2-carboxylic acid (CID 174935437) is N,N-diethylethanamine;5-(trifluoromethyl)thiophene-2-carboxylic acid.
What is the SMILES notation for N,N-diethylethanamine;5-(trifluoromethyl)thiophene-2-carboxylic acid?
The canonical SMILES for N,N-diethylethanamine;5-(trifluoromethyl)thiophene-2-carboxylic acid is CCN(CC)CC.O=C(O)c1ccc(C(F)(F)F)s1.
What is the InChIKey of N,N-diethylethanamine;5-(trifluoromethyl)thiophene-2-carboxylic acid?
The InChIKey is BBMFWKOLKXRJQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3F3O2S.C6H15N/c7-6(8,9)4-2-1-3(12-4)5(10)11;1-4-7(5-2)6-3/h1-2H,(H,10,11);4-6H2,1-3H3.
What are the key properties of N,N-diethylethanamine;5-(trifluoromethyl)thiophene-2-carboxylic acid?
N,N-diethylethanamine;5-(trifluoromethyl)thiophene-2-carboxylic acid has a molecular weight of 297.34 g/mol, XLogP of 3.81, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;5-(trifluoromethyl)thiophene-2-carboxylic acid is sourced from PubChem (CID 174935437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).