About bis(butanedioic acid);iminosilane
bis(butanedioic acid);iminosilane (PubChem CID 174936954) has the molecular formula C8H15NO8Si
and a molecular weight of 281.29 g/mol. Its IUPAC name is bis(butanedioic acid);iminosilane.
Molecular Properties
| Compound Name | bis(butanedioic acid);iminosilane |
| PubChem CID | 174936954 |
| Molecular Formula | C8H15NO8Si |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | bis(butanedioic acid);iminosilane |
| SMILES | O=C(O)CCC(=O)O.O=C(O)CCC(=O)O.[H]N=[SiH2] |
| InChI | InChI=1S/2C4H6O4.H3NSi/c2*5-3(6)1-2-4(7)8;1-2/h2*1-2H2,(H,5,6)(H,7,8);1H,2H2 |
| InChIKey | HNENFFOINCCGAW-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 173.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(butanedioic acid);iminosilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(butanedioic acid);iminosilane?
The IUPAC name of bis(butanedioic acid);iminosilane (CID 174936954) is bis(butanedioic acid);iminosilane.
What is the SMILES notation for bis(butanedioic acid);iminosilane?
The canonical SMILES for bis(butanedioic acid);iminosilane is O=C(O)CCC(=O)O.O=C(O)CCC(=O)O.[H]N=[SiH2].
What is the InChIKey of bis(butanedioic acid);iminosilane?
The InChIKey is HNENFFOINCCGAW-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H6O4.H3NSi/c2*5-3(6)1-2-4(7)8;1-2/h2*1-2H2,(H,5,6)(H,7,8);1H,2H2.
What are the key properties of bis(butanedioic acid);iminosilane?
bis(butanedioic acid);iminosilane has a molecular weight of 281.29 g/mol, XLogP of -0.75, 6 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(butanedioic acid);iminosilane is sourced from PubChem (CID 174936954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).