ethane-1,2-diol;3-(3-ethyloxiran-2-yl)propanoic acid

C9H18O5 — CID 174940719

IUPACethane-1,2-diol;3-(3-ethyloxiran-2-yl)propanoic acid
SMILESCCC1OC1CCC(=O)O.OCCO
InChIInChI=1S/C7H12O3.C2H6O2/c1-2-5-6(10-5)3-4-7(8)9;3-1-2-4/h5-6H,2-4H2,1H3,(H,8,9);3-4H,1-2H2
InChIKeyAJIAMTPVTCSMBL-UHFFFAOYSA-N
MW206.24 g/mol
LogP-0.00
Rot. Bonds5

About ethane-1,2-diol;3-(3-ethyloxiran-2-yl)propanoic acid

ethane-1,2-diol;3-(3-ethyloxiran-2-yl)propanoic acid (PubChem CID 174940719) has the molecular formula C9H18O5 and a molecular weight of 206.24 g/mol. Its IUPAC name is ethane-1,2-diol;3-(3-ethyloxiran-2-yl)propanoic acid.

Molecular Properties

Compound Nameethane-1,2-diol;3-(3-ethyloxiran-2-yl)propanoic acid
PubChem CID174940719
Molecular FormulaC9H18O5
Molecular Weight206.24 g/mol
Exact Mass206.12
IUPAC Nameethane-1,2-diol;3-(3-ethyloxiran-2-yl)propanoic acid
SMILESCCC1OC1CCC(=O)O.OCCO
InChIInChI=1S/C7H12O3.C2H6O2/c1-2-5-6(10-5)3-4-7(8)9;3-1-2-4/h5-6H,2-4H2,1H3,(H,8,9);3-4H,1-2H2
InChIKeyAJIAMTPVTCSMBL-UHFFFAOYSA-N
XLogP-0.00
TPSA90.29 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.24
LogP ≤ 5-0.00
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}

Analyze ethane-1,2-diol;3-(3-ethyloxiran-2-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane-1,2-diol;3-(3-ethyloxiran-2-yl)propanoic acid?
The IUPAC name of ethane-1,2-diol;3-(3-ethyloxiran-2-yl)propanoic acid (CID 174940719) is ethane-1,2-diol;3-(3-ethyloxiran-2-yl)propanoic acid.
What is the SMILES notation for ethane-1,2-diol;3-(3-ethyloxiran-2-yl)propanoic acid?
The canonical SMILES for ethane-1,2-diol;3-(3-ethyloxiran-2-yl)propanoic acid is CCC1OC1CCC(=O)O.OCCO.
What is the InChIKey of ethane-1,2-diol;3-(3-ethyloxiran-2-yl)propanoic acid?
The InChIKey is AJIAMTPVTCSMBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3.C2H6O2/c1-2-5-6(10-5)3-4-7(8)9;3-1-2-4/h5-6H,2-4H2,1H3,(H,8,9);3-4H,1-2H2.
What are the key properties of ethane-1,2-diol;3-(3-ethyloxiran-2-yl)propanoic acid?
ethane-1,2-diol;3-(3-ethyloxiran-2-yl)propanoic acid has a molecular weight of 206.24 g/mol, XLogP of -0.00, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane-1,2-diol;3-(3-ethyloxiran-2-yl)propanoic acid is sourced from PubChem (CID 174940719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).