C9H18O5 — CID 174940719
ethane-1,2-diol;3-(3-ethyloxiran-2-yl)propanoic acid (PubChem CID 174940719) has the molecular formula C9H18O5 and a molecular weight of 206.24 g/mol. Its IUPAC name is ethane-1,2-diol;3-(3-ethyloxiran-2-yl)propanoic acid.
| Compound Name | ethane-1,2-diol;3-(3-ethyloxiran-2-yl)propanoic acid |
|---|---|
| PubChem CID | 174940719 |
| Molecular Formula | C9H18O5 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | ethane-1,2-diol;3-(3-ethyloxiran-2-yl)propanoic acid |
| SMILES | CCC1OC1CCC(=O)O.OCCO |
| InChI | InChI=1S/C7H12O3.C2H6O2/c1-2-5-6(10-5)3-4-7(8)9;3-1-2-4/h5-6H,2-4H2,1H3,(H,8,9);3-4H,1-2H2 |
| InChIKey | AJIAMTPVTCSMBL-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|