C13H22N6O2 — CID 174941212
1-[3-(1,1-diaminopropan-2-yl)-5-(methylcarbamoylamino)phenyl]-3-methylurea (PubChem CID 174941212) has the molecular formula C13H22N6O2 and a molecular weight of 294.36 g/mol. Its IUPAC name is 1-[3-(1,1-diaminopropan-2-yl)-5-(methylcarbamoylamino)phenyl]-3-methylurea.
| Compound Name | 1-[3-(1,1-diaminopropan-2-yl)-5-(methylcarbamoylamino)phenyl]-3-methylurea |
|---|---|
| PubChem CID | 174941212 |
| Molecular Formula | C13H22N6O2 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 1-[3-(1,1-diaminopropan-2-yl)-5-(methylcarbamoylamino)phenyl]-3-methylurea |
| SMILES | CNC(=O)Nc1cc(NC(=O)NC)cc(C(C)C(N)N)c1 |
| InChI | InChI=1S/C13H22N6O2/c1-7(11(14)15)8-4-9(18-12(20)16-2)6-10(5-8)19-13(21)17-3/h4-7,11H,14-15H2,1-3H3,(H2,16,18,20)(H2,17,19,21) |
| InChIKey | OZIVHEWJGHDPPH-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|