C17H27NO5Si — CID 174944961
ethyl hydrogen carbonate;1,1,2-trimethyl-2-(4-nitrophenyl)silinane (PubChem CID 174944961) has the molecular formula C17H27NO5Si and a molecular weight of 353.49 g/mol. Its IUPAC name is ethyl hydrogen carbonate;1,1,2-trimethyl-2-(4-nitrophenyl)silinane.
| Compound Name | ethyl hydrogen carbonate;1,1,2-trimethyl-2-(4-nitrophenyl)silinane |
|---|---|
| PubChem CID | 174944961 |
| Molecular Formula | C17H27NO5Si |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | ethyl hydrogen carbonate;1,1,2-trimethyl-2-(4-nitrophenyl)silinane |
| SMILES | CC1(c2ccc([N+](=O)[O-])cc2)CCCC[Si]1(C)C.CCOC(=O)O |
| InChI | InChI=1S/C14H21NO2Si.C3H6O3/c1-14(10-4-5-11-18(14,2)3)12-6-8-13(9-7-12)15(16)17;1-2-6-3(4)5/h6-9H,4-5,10-11H2,1-3H3;2H2,1H3,(H,4,5) |
| InChIKey | MEUBELAVMLSZIF-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|