C10H9ClN2 — CID 174947620
3-chloro-2,8-dimethyl-1,7-naphthyridine (PubChem CID 174947620) has the molecular formula C10H9ClN2 and a molecular weight of 192.65 g/mol. Its IUPAC name is 3-chloro-2,8-dimethyl-1,7-naphthyridine.
| Compound Name | 3-chloro-2,8-dimethyl-1,7-naphthyridine |
|---|---|
| PubChem CID | 174947620 |
| Molecular Formula | C10H9ClN2 |
| Molecular Weight | 192.65 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 3-chloro-2,8-dimethyl-1,7-naphthyridine |
| SMILES | Cc1nc2c(C)nccc2cc1Cl |
| InChI | InChI=1S/C10H9ClN2/c1-6-9(11)5-8-3-4-12-7(2)10(8)13-6/h3-5H,1-2H3 |
| InChIKey | DNHUVGDHEIEECV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.65 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |