C22H27N3O4 — CID 174953209
2-[(dibenzylamino)methyl]-2-methylpiperazine-1,4-dicarboxylic acid (PubChem CID 174953209) has the molecular formula C22H27N3O4 and a molecular weight of 397.47 g/mol. Its IUPAC name is 2-[(dibenzylamino)methyl]-2-methylpiperazine-1,4-dicarboxylic acid.
| Compound Name | 2-[(dibenzylamino)methyl]-2-methylpiperazine-1,4-dicarboxylic acid |
|---|---|
| PubChem CID | 174953209 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 2-[(dibenzylamino)methyl]-2-methylpiperazine-1,4-dicarboxylic acid |
| SMILES | CC1(CN(Cc2ccccc2)Cc2ccccc2)CN(C(=O)O)CCN1C(=O)O |
| InChI | InChI=1S/C22H27N3O4/c1-22(17-24(20(26)27)12-13-25(22)21(28)29)16-23(14-18-8-4-2-5-9-18)15-19-10-6-3-7-11-19/h2-11H,12-17H2,1H3,(H,26,27)(H,28,29) |
| InChIKey | WOZYVLWMINLECH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |