C28H41NO4 — CID 174958376
[(4-hydroxy-3-methoxyphenyl)methylamino] icosa-5,8,11,14-tetraenoate (PubChem CID 174958376) has the molecular formula C28H41NO4 and a molecular weight of 455.64 g/mol. Its IUPAC name is [(4-hydroxy-3-methoxyphenyl)methylamino] icosa-5,8,11,14-tetraenoate.
| Compound Name | [(4-hydroxy-3-methoxyphenyl)methylamino] icosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 174958376 |
| Molecular Formula | C28H41NO4 |
| Molecular Weight | 455.64 g/mol |
| Exact Mass | 455.30 |
| IUPAC Name | [(4-hydroxy-3-methoxyphenyl)methylamino] icosa-5,8,11,14-tetraenoate |
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCC(=O)ONCc1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C28H41NO4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-28(31)33-29-24-25-21-22-26(30)27(23-25)32-2/h7-8,10-11,13-14,16-17,21-23,29-30H,3-6,9,12,15,18-20,24H2,1-2H3 |
| InChIKey | HIRYJONQDGNZNQ-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.64 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|