C30H45NO4 — CID 85096843
20-hydroxy-N-[(4-hydroxy-3-methoxyphenyl)methyl]-16,16-dimethylicosa-5,8,11,14-tetraenamide (PubChem CID 85096843) has the molecular formula C30H45NO4 and a molecular weight of 483.69 g/mol. Its IUPAC name is 20-hydroxy-N-[(4-hydroxy-3-methoxyphenyl)methyl]-16,16-dimethylicosa-5,8,11,14-tetraenamide.
| Compound Name | 20-hydroxy-N-[(4-hydroxy-3-methoxyphenyl)methyl]-16,16-dimethylicosa-5,8,11,14-tetraenamide |
|---|---|
| PubChem CID | 85096843 |
| Molecular Formula | C30H45NO4 |
| Molecular Weight | 483.69 g/mol |
| Exact Mass | 483.33 |
| IUPAC Name | 20-hydroxy-N-[(4-hydroxy-3-methoxyphenyl)methyl]-16,16-dimethylicosa-5,8,11,14-tetraenamide |
| SMILES | COc1cc(CNC(=O)CCCC=CCC=CCC=CCC=CC(C)(C)CCCCO)ccc1O |
| InChI | InChI=1S/C30H45NO4/c1-30(2,22-16-17-23-32)21-15-13-11-9-7-5-4-6-8-10-12-14-18-29(34)31-25-26-19-20-27(33)28(24-26)35-3/h4-5,8-11,15,19-21,24,32-33H,6-7,12-14,16-18,22-23,25H2,1-3H3,(H,31,34) |
| InChIKey | FFISVAAPMVVGIX-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.69 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|