C26H43NO4 — CID 66562707
(Z)-N-hydroxy-N-[(4-hydroxy-3-methoxyphenyl)methyl]octadec-9-enamide (PubChem CID 66562707) has the molecular formula C26H43NO4 and a molecular weight of 433.63 g/mol. Its IUPAC name is (Z)-N-hydroxy-N-[(4-hydroxy-3-methoxyphenyl)methyl]octadec-9-enamide.
| Compound Name | (Z)-N-hydroxy-N-[(4-hydroxy-3-methoxyphenyl)methyl]octadec-9-enamide |
|---|---|
| PubChem CID | 66562707 |
| Molecular Formula | C26H43NO4 |
| Molecular Weight | 433.63 g/mol |
| Exact Mass | 433.32 |
| IUPAC Name | (Z)-N-hydroxy-N-[(4-hydroxy-3-methoxyphenyl)methyl]octadec-9-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N(O)Cc1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C26H43NO4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-26(29)27(30)22-23-19-20-24(28)25(21-23)31-2/h10-11,19-21,28,30H,3-9,12-18,22H2,1-2H3/b11-10- |
| InChIKey | CCJBZOGAXOHBTF-KHPPLWFESA-N |
| XLogP | 7.16 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.63 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|