C10H11FO3S — CID 174959482
(7-fluoro-3-hydroxy-2,3-dihydro-1H-inden-4-yl)methanesulfinic acid (PubChem CID 174959482) has the molecular formula C10H11FO3S and a molecular weight of 230.26 g/mol. Its IUPAC name is (7-fluoro-3-hydroxy-2,3-dihydro-1H-inden-4-yl)methanesulfinic acid.
| Compound Name | (7-fluoro-3-hydroxy-2,3-dihydro-1H-inden-4-yl)methanesulfinic acid |
|---|---|
| PubChem CID | 174959482 |
| Molecular Formula | C10H11FO3S |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | (7-fluoro-3-hydroxy-2,3-dihydro-1H-inden-4-yl)methanesulfinic acid |
| SMILES | O=S(O)Cc1ccc(F)c2c1C(O)CC2 |
| InChI | InChI=1S/C10H11FO3S/c11-8-3-1-6(5-15(13)14)10-7(8)2-4-9(10)12/h1,3,9,12H,2,4-5H2,(H,13,14) |
| InChIKey | FSYXHCPEOKCFOY-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|