C9H6F4O — CID 130114805
4,5,6,7-tetrafluoro-2,3-dihydro-1H-inden-1-ol (PubChem CID 130114805) has the molecular formula C9H6F4O and a molecular weight of 206.14 g/mol. Its IUPAC name is 4,5,6,7-tetrafluoro-2,3-dihydro-1H-inden-1-ol.
| Compound Name | 4,5,6,7-tetrafluoro-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 130114805 |
| Molecular Formula | C9H6F4O |
| Molecular Weight | 206.14 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | 4,5,6,7-tetrafluoro-2,3-dihydro-1H-inden-1-ol |
| SMILES | OC1CCc2c(F)c(F)c(F)c(F)c21 |
| InChI | InChI=1S/C9H6F4O/c10-6-3-1-2-4(14)5(3)7(11)9(13)8(6)12/h4,14H,1-2H2 |
| InChIKey | SREHTDPNNCZQPF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.14 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|