C10H9ClF2O — CID 107477727
(1R)-5-chloro-7,8-difluoro-1,2,3,4-tetrahydronaphthalen-1-ol (PubChem CID 107477727) has the molecular formula C10H9ClF2O and a molecular weight of 218.63 g/mol. Its IUPAC name is (1R)-5-chloro-7,8-difluoro-1,2,3,4-tetrahydronaphthalen-1-ol.
| Compound Name | (1R)-5-chloro-7,8-difluoro-1,2,3,4-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 107477727 |
| Molecular Formula | C10H9ClF2O |
| Molecular Weight | 218.63 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | (1R)-5-chloro-7,8-difluoro-1,2,3,4-tetrahydronaphthalen-1-ol |
| SMILES | O[C@@H]1CCCc2c(Cl)cc(F)c(F)c21 |
| InChI | InChI=1S/C10H9ClF2O/c11-6-4-7(12)10(13)9-5(6)2-1-3-8(9)14/h4,8,14H,1-3H2/t8-/m1/s1 |
| InChIKey | MNROXFBUTPXAMX-MRVPVSSYSA-N |
| XLogP | 2.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.63 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|