C10H12ClNO2 — CID 130060029
8-amino-4-chloro-5,6,7,8-tetrahydronaphthalene-1,2-diol (PubChem CID 130060029) has the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. Its IUPAC name is 8-amino-4-chloro-5,6,7,8-tetrahydronaphthalene-1,2-diol.
| Compound Name | 8-amino-4-chloro-5,6,7,8-tetrahydronaphthalene-1,2-diol |
|---|---|
| PubChem CID | 130060029 |
| Molecular Formula | C10H12ClNO2 |
| Molecular Weight | 213.66 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 8-amino-4-chloro-5,6,7,8-tetrahydronaphthalene-1,2-diol |
| SMILES | NC1CCCc2c(Cl)cc(O)c(O)c21 |
| InChI | InChI=1S/C10H12ClNO2/c11-6-4-8(13)10(14)9-5(6)2-1-3-7(9)12/h4,7,13-14H,1-3,12H2 |
| InChIKey | DGWIKCLNQKLDMW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.66 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|