C14H18ClF2N — CID 107477722
1-chloro-3,4-difluoro-N-propyl-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-amine (PubChem CID 107477722) has the molecular formula C14H18ClF2N and a molecular weight of 273.75 g/mol. Its IUPAC name is 1-chloro-3,4-difluoro-N-propyl-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-amine.
| Compound Name | 1-chloro-3,4-difluoro-N-propyl-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-amine |
|---|---|
| PubChem CID | 107477722 |
| Molecular Formula | C14H18ClF2N |
| Molecular Weight | 273.75 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 1-chloro-3,4-difluoro-N-propyl-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-amine |
| SMILES | CCCNC1CCCCc2c(Cl)cc(F)c(F)c21 |
| InChI | InChI=1S/C14H18ClF2N/c1-2-7-18-12-6-4-3-5-9-10(15)8-11(16)14(17)13(9)12/h8,12,18H,2-7H2,1H3 |
| InChIKey | IFSKAYUVXFBAJL-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.75 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|