C9H10O2S — CID 145171069
7-sulfanyl-2,3-dihydro-1H-indene-1,4-diol (PubChem CID 145171069) has the molecular formula C9H10O2S and a molecular weight of 182.24 g/mol. Its IUPAC name is 7-sulfanyl-2,3-dihydro-1H-indene-1,4-diol.
| Compound Name | 7-sulfanyl-2,3-dihydro-1H-indene-1,4-diol |
|---|---|
| PubChem CID | 145171069 |
| Molecular Formula | C9H10O2S |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | 7-sulfanyl-2,3-dihydro-1H-indene-1,4-diol |
| SMILES | Oc1ccc(S)c2c1CCC2O |
| InChI | InChI=1S/C9H10O2S/c10-6-3-4-8(12)9-5(6)1-2-7(9)11/h3-4,7,10-12H,1-2H2 |
| InChIKey | OHKXGYHHFDTXMP-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|