C20H18O2 — CID 156581883
(3R)-1,2,3,10,11,12-hexahydroperylene-3,9-diol (PubChem CID 156581883) has the molecular formula C20H18O2 and a molecular weight of 290.36 g/mol. Its IUPAC name is (3R)-1,2,3,10,11,12-hexahydroperylene-3,9-diol.
| Compound Name | (3R)-1,2,3,10,11,12-hexahydroperylene-3,9-diol |
|---|---|
| PubChem CID | 156581883 |
| Molecular Formula | C20H18O2 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | (3R)-1,2,3,10,11,12-hexahydroperylene-3,9-diol |
| SMILES | Oc1ccc2c3c1CCCc3c1c3c(cccc32)[C@H](O)CC1 |
| InChI | InChI=1S/C20H18O2/c21-17-9-8-14-12-4-2-6-16-18(22)10-7-13(20(12)16)11-3-1-5-15(17)19(11)14/h1,3,5,7,10,17,21-22H,2,4,6,8-9H2/t17-/m1/s1 |
| InChIKey | GVTNCLLILDBBLI-QGZVFWFLSA-N |
| XLogP | 4.17 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|