C15H16O — CID 79014499
(1S)-9-methyl-1,2,3,4-tetrahydrophenanthren-1-ol (PubChem CID 79014499) has the molecular formula C15H16O and a molecular weight of 212.29 g/mol. Its IUPAC name is (1S)-9-methyl-1,2,3,4-tetrahydrophenanthren-1-ol.
| Compound Name | (1S)-9-methyl-1,2,3,4-tetrahydrophenanthren-1-ol |
|---|---|
| PubChem CID | 79014499 |
| Molecular Formula | C15H16O |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | (1S)-9-methyl-1,2,3,4-tetrahydrophenanthren-1-ol |
| SMILES | Cc1cc2c(c3ccccc13)CCC[C@@H]2O |
| InChI | InChI=1S/C15H16O/c1-10-9-14-13(7-4-8-15(14)16)12-6-3-2-5-11(10)12/h2-3,5-6,9,15-16H,4,7-8H2,1H3/t15-/m0/s1 |
| InChIKey | QTAWZEHQVXKQIL-HNNXBMFYSA-N |
| XLogP | 3.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |