C31H28O4 — CID 174324833
methyl 5-methoxynaphthalene-1-carboxylate;1,2,3,4-tetrahydrochrysen-1-ol (PubChem CID 174324833) has the molecular formula C31H28O4 and a molecular weight of 464.56 g/mol. Its IUPAC name is methyl 5-methoxynaphthalene-1-carboxylate;1,2,3,4-tetrahydrochrysen-1-ol.
| Compound Name | methyl 5-methoxynaphthalene-1-carboxylate;1,2,3,4-tetrahydrochrysen-1-ol |
|---|---|
| PubChem CID | 174324833 |
| Molecular Formula | C31H28O4 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | methyl 5-methoxynaphthalene-1-carboxylate;1,2,3,4-tetrahydrochrysen-1-ol |
| SMILES | COC(=O)c1cccc2c(OC)cccc12.OC1CCCc2c1ccc1c2ccc2ccccc21 |
| InChI | InChI=1S/C18H16O.C13H12O3/c19-18-7-3-6-14-16-9-8-12-4-1-2-5-13(12)15(16)10-11-17(14)18;1-15-12-8-4-5-9-10(12)6-3-7-11(9)13(14)16-2/h1-2,4-5,8-11,18-19H,3,6-7H2;3-8H,1-2H3 |
| InChIKey | WODRWXAUQQFFMV-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|