C8H3F5 — CID 23262367
2,3,4,5,7-pentafluorobicyclo[4.2.0]octa-1(6),2,4-triene (PubChem CID 23262367) has the molecular formula C8H3F5 and a molecular weight of 194.10 g/mol. Its IUPAC name is 2,3,4,5,7-pentafluorobicyclo[4.2.0]octa-1(6),2,4-triene.
| Compound Name | 2,3,4,5,7-pentafluorobicyclo[4.2.0]octa-1(6),2,4-triene |
|---|---|
| PubChem CID | 23262367 |
| Molecular Formula | C8H3F5 |
| Molecular Weight | 194.10 g/mol |
| Exact Mass | 194.02 |
| IUPAC Name | 2,3,4,5,7-pentafluorobicyclo[4.2.0]octa-1(6),2,4-triene |
| SMILES | Fc1c(F)c(F)c2c(c1F)CC2F |
| InChI | InChI=1S/C8H3F5/c9-3-1-2-4(3)6(11)8(13)7(12)5(2)10/h3H,1H2 |
| InChIKey | KTUXOPQVTKABFI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.10 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|