C9H3ClF4O2 — CID 171365743
1-chloro-5,6,7,8-tetrafluoro-1,4-dihydroisochromen-3-one (PubChem CID 171365743) has the molecular formula C9H3ClF4O2 and a molecular weight of 254.57 g/mol. Its IUPAC name is 1-chloro-5,6,7,8-tetrafluoro-1,4-dihydroisochromen-3-one.
| Compound Name | 1-chloro-5,6,7,8-tetrafluoro-1,4-dihydroisochromen-3-one |
|---|---|
| PubChem CID | 171365743 |
| Molecular Formula | C9H3ClF4O2 |
| Molecular Weight | 254.57 g/mol |
| Exact Mass | 253.98 |
| IUPAC Name | 1-chloro-5,6,7,8-tetrafluoro-1,4-dihydroisochromen-3-one |
| SMILES | O=C1Cc2c(F)c(F)c(F)c(F)c2C(Cl)O1 |
| InChI | InChI=1S/C9H3ClF4O2/c10-9-4-2(1-3(15)16-9)5(11)7(13)8(14)6(4)12/h9H,1H2 |
| InChIKey | RTKXYYZTCZLNOC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.57 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|