C21H12F6O3 — CID 101119130
2,8,10,16,20,21-hexafluorotetracyclo[7.7.3.13,15.17,11]henicosa-1(16),2,7,9,11(21),15(20)-hexaene-5,13,18-trione (PubChem CID 101119130) has the molecular formula C21H12F6O3 and a molecular weight of 426.31 g/mol. Its IUPAC name is 2,8,10,16,20,21-hexafluorotetracyclo[7.7.3.13,15.17,11]henicosa-1(16),2,7,9,11(21),15(20)-hexaene-5,13,18-trione.
| Compound Name | 2,8,10,16,20,21-hexafluorotetracyclo[7.7.3.13,15.17,11]henicosa-1(16),2,7,9,11(21),15(20)-hexaene-5,13,18-trione |
|---|---|
| PubChem CID | 101119130 |
| Molecular Formula | C21H12F6O3 |
| Molecular Weight | 426.31 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | 2,8,10,16,20,21-hexafluorotetracyclo[7.7.3.13,15.17,11]henicosa-1(16),2,7,9,11(21),15(20)-hexaene-5,13,18-trione |
| SMILES | O=C1Cc2c(F)c3c(F)c(c2F)CC(=O)Cc2c(F)c(c(F)c(c2F)CC(=O)C3)C1 |
| InChI | InChI=1S/C21H12F6O3/c22-16-10-1-7(28)2-11-18(24)14-5-8(29)3-12(16)20(26)13(17(10)23)4-9(30)6-15(19(11)25)21(14)27/h1-6H2 |
| InChIKey | PVNFRYNDLSLIGQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.31 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |