C23H6F15Na — CID 134976624
sodium 1-[2,3-bis(2,3,4,5,6-pentafluorophenyl)cyclopentyl]-2,3,4,5,6-pentafluorobenzene (PubChem CID 134976624) has the molecular formula C23H6F15Na and a molecular weight of 590.26 g/mol. Its IUPAC name is sodium 1-[2,3-bis(2,3,4,5,6-pentafluorophenyl)cyclopentyl]-2,3,4,5,6-pentafluorobenzene.
| Compound Name | sodium 1-[2,3-bis(2,3,4,5,6-pentafluorophenyl)cyclopentyl]-2,3,4,5,6-pentafluorobenzene |
|---|---|
| PubChem CID | 134976624 |
| Molecular Formula | C23H6F15Na |
| Molecular Weight | 590.26 g/mol |
| Exact Mass | 590.01 |
| IUPAC Name | sodium 1-[2,3-bis(2,3,4,5,6-pentafluorophenyl)cyclopentyl]-2,3,4,5,6-pentafluorobenzene |
| SMILES | Fc1c(F)c(F)c(C2[CH-]CC(c3c(F)c(F)c(F)c(F)c3F)C2c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.[Na+] |
| InChI | InChI=1S/C23H6F15.Na/c24-9-6(10(25)16(31)21(36)15(9)30)3-1-2-4(7-11(26)17(32)22(37)18(33)12(7)27)5(3)8-13(28)19(34)23(38)20(35)14(8)29;/h1,3-5H,2H2;/q-1;+1 |
| InChIKey | WTRURNAFEZZSSA-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.26 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|