C9H6F3K — CID 167407813
potassium 5-cyclopropyl-1,2,3-trifluorobenzene (PubChem CID 167407813) has the molecular formula C9H6F3K and a molecular weight of 210.24 g/mol. Its IUPAC name is potassium 5-cyclopropyl-1,2,3-trifluorobenzene.
| Compound Name | potassium 5-cyclopropyl-1,2,3-trifluorobenzene |
|---|---|
| PubChem CID | 167407813 |
| Molecular Formula | C9H6F3K |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.01 |
| IUPAC Name | potassium 5-cyclopropyl-1,2,3-trifluorobenzene |
| SMILES | Fc1cc(C2[CH-]C2)cc(F)c1F.[K+] |
| InChI | InChI=1S/C9H6F3.K/c10-7-3-6(5-1-2-5)4-8(11)9(7)12;/h1,3-5H,2H2;/q-1;+1 |
| InChIKey | XURWMXHWJLJMNQ-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|