C13H11F3O2 — CID 101361663
(1R,5S)-3-(3,4,5-trifluorophenyl)bicyclo[3.1.0]hexane-6-carboxylic acid (PubChem CID 101361663) has the molecular formula C13H11F3O2 and a molecular weight of 256.22 g/mol. Its IUPAC name is (1R,5S)-3-(3,4,5-trifluorophenyl)bicyclo[3.1.0]hexane-6-carboxylic acid.
| Compound Name | (1R,5S)-3-(3,4,5-trifluorophenyl)bicyclo[3.1.0]hexane-6-carboxylic acid |
|---|---|
| PubChem CID | 101361663 |
| Molecular Formula | C13H11F3O2 |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | (1R,5S)-3-(3,4,5-trifluorophenyl)bicyclo[3.1.0]hexane-6-carboxylic acid |
| SMILES | O=C(O)C1[C@H]2CC(c3cc(F)c(F)c(F)c3)C[C@@H]12 |
| InChI | InChI=1S/C13H11F3O2/c14-9-3-6(4-10(15)12(9)16)5-1-7-8(2-5)11(7)13(17)18/h3-5,7-8,11H,1-2H2,(H,17,18)/t5?,7-,8+,11? |
| InChIKey | ZECIADLVZBAMHS-NOPILPNCSA-N |
| XLogP | 2.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|