2-oxo-4-(3,4,5-trifluorophenyl)cyclopentane-1-carboxylic acid

C12H9F3O3 — CID 67633399

IUPAC2-oxo-4-(3,4,5-trifluorophenyl)cyclopentane-1-carboxylic acid
SMILESO=C(O)C1CC(c2cc(F)c(F)c(F)c2)CC1=O
InChIInChI=1S/C12H9F3O3/c13-8-2-6(3-9(14)11(8)15)5-1-7(12(17)18)10(16)4-5/h2-3,5,7H,1,4H2,(H,17,18)
InChIKeyXDQBKNJELHXXAW-UHFFFAOYSA-N
MW258.19 g/mol
LogP2.25
Rot. Bonds2

About 2-oxo-4-(3,4,5-trifluorophenyl)cyclopentane-1-carboxylic acid

2-oxo-4-(3,4,5-trifluorophenyl)cyclopentane-1-carboxylic acid (PubChem CID 67633399) has the molecular formula C12H9F3O3 and a molecular weight of 258.19 g/mol. Its IUPAC name is 2-oxo-4-(3,4,5-trifluorophenyl)cyclopentane-1-carboxylic acid.

Molecular Properties

Compound Name2-oxo-4-(3,4,5-trifluorophenyl)cyclopentane-1-carboxylic acid
PubChem CID67633399
Molecular FormulaC12H9F3O3
Molecular Weight258.19 g/mol
Exact Mass258.05
IUPAC Name2-oxo-4-(3,4,5-trifluorophenyl)cyclopentane-1-carboxylic acid
SMILESO=C(O)C1CC(c2cc(F)c(F)c(F)c2)CC1=O
InChIInChI=1S/C12H9F3O3/c13-8-2-6(3-9(14)11(8)15)5-1-7(12(17)18)10(16)4-5/h2-3,5,7H,1,4H2,(H,17,18)
InChIKeyXDQBKNJELHXXAW-UHFFFAOYSA-N
XLogP2.25
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.19
LogP ≤ 52.25
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}

Analyze 2-oxo-4-(3,4,5-trifluorophenyl)cyclopentane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-oxo-4-(3,4,5-trifluorophenyl)cyclopentane-1-carboxylic acid?
The IUPAC name of 2-oxo-4-(3,4,5-trifluorophenyl)cyclopentane-1-carboxylic acid (CID 67633399) is 2-oxo-4-(3,4,5-trifluorophenyl)cyclopentane-1-carboxylic acid.
What is the SMILES notation for 2-oxo-4-(3,4,5-trifluorophenyl)cyclopentane-1-carboxylic acid?
The canonical SMILES for 2-oxo-4-(3,4,5-trifluorophenyl)cyclopentane-1-carboxylic acid is O=C(O)C1CC(c2cc(F)c(F)c(F)c2)CC1=O.
What is the InChIKey of 2-oxo-4-(3,4,5-trifluorophenyl)cyclopentane-1-carboxylic acid?
The InChIKey is XDQBKNJELHXXAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9F3O3/c13-8-2-6(3-9(14)11(8)15)5-1-7(12(17)18)10(16)4-5/h2-3,5,7H,1,4H2,(H,17,18).
What are the key properties of 2-oxo-4-(3,4,5-trifluorophenyl)cyclopentane-1-carboxylic acid?
2-oxo-4-(3,4,5-trifluorophenyl)cyclopentane-1-carboxylic acid has a molecular weight of 258.19 g/mol, XLogP of 2.25, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-4-(3,4,5-trifluorophenyl)cyclopentane-1-carboxylic acid is sourced from PubChem (CID 67633399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).