C12H9F3O3 — CID 67633399
2-oxo-4-(3,4,5-trifluorophenyl)cyclopentane-1-carboxylic acid (PubChem CID 67633399) has the molecular formula C12H9F3O3 and a molecular weight of 258.19 g/mol. Its IUPAC name is 2-oxo-4-(3,4,5-trifluorophenyl)cyclopentane-1-carboxylic acid.
| Compound Name | 2-oxo-4-(3,4,5-trifluorophenyl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 67633399 |
| Molecular Formula | C12H9F3O3 |
| Molecular Weight | 258.19 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 2-oxo-4-(3,4,5-trifluorophenyl)cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1CC(c2cc(F)c(F)c(F)c2)CC1=O |
| InChI | InChI=1S/C12H9F3O3/c13-8-2-6(3-9(14)11(8)15)5-1-7(12(17)18)10(16)4-5/h2-3,5,7H,1,4H2,(H,17,18) |
| InChIKey | XDQBKNJELHXXAW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.19 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|