C11H9F3O — CID 143335161
2-(3,4,5-trifluorophenyl)-3,6-dihydro-2H-pyran (PubChem CID 143335161) has the molecular formula C11H9F3O and a molecular weight of 214.19 g/mol. Its IUPAC name is 2-(3,4,5-trifluorophenyl)-3,6-dihydro-2H-pyran.
| Compound Name | 2-(3,4,5-trifluorophenyl)-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 143335161 |
| Molecular Formula | C11H9F3O |
| Molecular Weight | 214.19 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 2-(3,4,5-trifluorophenyl)-3,6-dihydro-2H-pyran |
| SMILES | Fc1cc(C2CC=CCO2)cc(F)c1F |
| InChI | InChI=1S/C11H9F3O/c12-8-5-7(6-9(13)11(8)14)10-3-1-2-4-15-10/h1-2,5-6,10H,3-4H2 |
| InChIKey | WMENOQOVCYSBDK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.19 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|