About 2,3,7-trifluorobicyclo[3.1.1]hepta-1,3,5-triene
2,3,7-trifluorobicyclo[3.1.1]hepta-1,3,5-triene (PubChem CID 68804796) has the molecular formula C7H3F3
and a molecular weight of 144.09 g/mol. Its IUPAC name is 2,3,7-trifluorobicyclo[3.1.1]hepta-1,3,5-triene.
Analyze 2,3,7-trifluorobicyclo[3.1.1]hepta-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,7-trifluorobicyclo[3.1.1]hepta-1,3,5-triene?
The IUPAC name of 2,3,7-trifluorobicyclo[3.1.1]hepta-1,3,5-triene (CID 68804796) is 2,3,7-trifluorobicyclo[3.1.1]hepta-1,3,5-triene.
What is the SMILES notation for 2,3,7-trifluorobicyclo[3.1.1]hepta-1,3,5-triene?
The canonical SMILES for 2,3,7-trifluorobicyclo[3.1.1]hepta-1,3,5-triene is Fc1cc2cc(c1F)C2F.
What is the InChIKey of 2,3,7-trifluorobicyclo[3.1.1]hepta-1,3,5-triene?
The InChIKey is FFPBNFQXEOWQGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3F3/c8-5-2-3-1-4(6(3)9)7(5)10/h1-2,6H.
What are the key properties of 2,3,7-trifluorobicyclo[3.1.1]hepta-1,3,5-triene?
2,3,7-trifluorobicyclo[3.1.1]hepta-1,3,5-triene has a molecular weight of 144.09 g/mol, XLogP of 2.34, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,7-trifluorobicyclo[3.1.1]hepta-1,3,5-triene is sourced from PubChem (CID 68804796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).