C12H8F4O — CID 23264797
(1S,8S,9S)-3,4,5,6-tetrafluorotricyclo[6.3.1.02,7]dodeca-2(7),3,5,10-tetraen-9-ol (PubChem CID 23264797) has the molecular formula C12H8F4O and a molecular weight of 244.19 g/mol. Its IUPAC name is (1S,8S,9S)-3,4,5,6-tetrafluorotricyclo[6.3.1.02,7]dodeca-2(7),3,5,10-tetraen-9-ol.
| Compound Name | (1S,8S,9S)-3,4,5,6-tetrafluorotricyclo[6.3.1.02,7]dodeca-2(7),3,5,10-tetraen-9-ol |
|---|---|
| PubChem CID | 23264797 |
| Molecular Formula | C12H8F4O |
| Molecular Weight | 244.19 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | (1S,8S,9S)-3,4,5,6-tetrafluorotricyclo[6.3.1.02,7]dodeca-2(7),3,5,10-tetraen-9-ol |
| SMILES | O[C@H]1C=C[C@@H]2C[C@H]1c1c(F)c(F)c(F)c(F)c12 |
| InChI | InChI=1S/C12H8F4O/c13-9-7-4-1-2-6(17)5(3-4)8(7)10(14)12(16)11(9)15/h1-2,4-6,17H,3H2/t4-,5-,6+/m1/s1 |
| InChIKey | WUGITHHHAHGXHJ-PBXRRBTRSA-N |
| XLogP | 2.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.19 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|