C15H12F4O2 — CID 90482676
1-(11-acetyl-3,4,5,6-tetrafluoro-11-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)ethanone (PubChem CID 90482676) has the molecular formula C15H12F4O2 and a molecular weight of 300.25 g/mol. Its IUPAC name is 1-(11-acetyl-3,4,5,6-tetrafluoro-11-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)ethanone.
| Compound Name | 1-(11-acetyl-3,4,5,6-tetrafluoro-11-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)ethanone |
|---|---|
| PubChem CID | 90482676 |
| Molecular Formula | C15H12F4O2 |
| Molecular Weight | 300.25 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 1-(11-acetyl-3,4,5,6-tetrafluoro-11-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)ethanone |
| SMILES | CC(=O)C1(C(C)=O)C2CCC1c1c(F)c(F)c(F)c(F)c12 |
| InChI | InChI=1S/C15H12F4O2/c1-5(20)15(6(2)21)7-3-4-8(15)10-9(7)11(16)13(18)14(19)12(10)17/h7-8H,3-4H2,1-2H3 |
| InChIKey | FKMRWILCPVDYRN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.25 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|