C13H10F4O — CID 13184198
3,4,5,6-tetrafluoro-8-methyltricyclo[6.3.1.02,7]dodeca-2(7),3,5-trien-9-one (PubChem CID 13184198) has the molecular formula C13H10F4O and a molecular weight of 258.21 g/mol. Its IUPAC name is 3,4,5,6-tetrafluoro-8-methyltricyclo[6.3.1.02,7]dodeca-2(7),3,5-trien-9-one.
| Compound Name | 3,4,5,6-tetrafluoro-8-methyltricyclo[6.3.1.02,7]dodeca-2(7),3,5-trien-9-one |
|---|---|
| PubChem CID | 13184198 |
| Molecular Formula | C13H10F4O |
| Molecular Weight | 258.21 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 3,4,5,6-tetrafluoro-8-methyltricyclo[6.3.1.02,7]dodeca-2(7),3,5-trien-9-one |
| SMILES | CC12CC(CCC1=O)c1c(F)c(F)c(F)c(F)c12 |
| InChI | InChI=1S/C13H10F4O/c1-13-4-5(2-3-6(13)18)7-8(13)10(15)12(17)11(16)9(7)14/h5H,2-4H2,1H3 |
| InChIKey | ARZAGODMXQUFEQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.21 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|