C18H14F4O — CID 23267672
3,4,5,6-tetrafluoro-11-phenyltricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-ol (PubChem CID 23267672) has the molecular formula C18H14F4O and a molecular weight of 322.30 g/mol. Its IUPAC name is 3,4,5,6-tetrafluoro-11-phenyltricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-ol.
| Compound Name | 3,4,5,6-tetrafluoro-11-phenyltricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-ol |
|---|---|
| PubChem CID | 23267672 |
| Molecular Formula | C18H14F4O |
| Molecular Weight | 322.30 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 3,4,5,6-tetrafluoro-11-phenyltricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-ol |
| SMILES | OC1(c2ccccc2)CC2Cc3c(F)c(F)c(F)c(F)c3C1C2 |
| InChI | InChI=1S/C18H14F4O/c19-14-11-6-9-7-12(13(11)15(20)17(22)16(14)21)18(23,8-9)10-4-2-1-3-5-10/h1-5,9,12,23H,6-8H2 |
| InChIKey | QUZGIONZKYRMBC-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.30 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|