C20H22O2 — CID 102394801
(1R,2R,4S,6S)-2-(4-phenylphenyl)bicyclo[2.2.2]octane-2,6-diol (PubChem CID 102394801) has the molecular formula C20H22O2 and a molecular weight of 294.39 g/mol. Its IUPAC name is (1R,2R,4S,6S)-2-(4-phenylphenyl)bicyclo[2.2.2]octane-2,6-diol.
| Compound Name | (1R,2R,4S,6S)-2-(4-phenylphenyl)bicyclo[2.2.2]octane-2,6-diol |
|---|---|
| PubChem CID | 102394801 |
| Molecular Formula | C20H22O2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | (1R,2R,4S,6S)-2-(4-phenylphenyl)bicyclo[2.2.2]octane-2,6-diol |
| SMILES | O[C@H]1C[C@@H]2CC[C@H]1[C@@](O)(c1ccc(-c3ccccc3)cc1)C2 |
| InChI | InChI=1S/C20H22O2/c21-19-12-14-6-11-18(19)20(22,13-14)17-9-7-16(8-10-17)15-4-2-1-3-5-15/h1-5,7-10,14,18-19,21-22H,6,11-13H2/t14-,18+,19-,20-/m0/s1 |
| InChIKey | MHRTZFHZLFMIHL-WBCYEJBOSA-N |
| XLogP | 3.72 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |