C9H10FNO — CID 130645514
(3R)-3-amino-7-fluoro-2,3-dihydro-1H-inden-4-ol (PubChem CID 130645514) has the molecular formula C9H10FNO and a molecular weight of 167.18 g/mol. Its IUPAC name is (3R)-3-amino-7-fluoro-2,3-dihydro-1H-inden-4-ol.
| Compound Name | (3R)-3-amino-7-fluoro-2,3-dihydro-1H-inden-4-ol |
|---|---|
| PubChem CID | 130645514 |
| Molecular Formula | C9H10FNO |
| Molecular Weight | 167.18 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | (3R)-3-amino-7-fluoro-2,3-dihydro-1H-inden-4-ol |
| SMILES | N[C@@H]1CCc2c(F)ccc(O)c21 |
| InChI | InChI=1S/C9H10FNO/c10-6-2-4-8(12)9-5(6)1-3-7(9)11/h2,4,7,12H,1,3,11H2/t7-/m1/s1 |
| InChIKey | RKLJMNWLEMKGNQ-SSDOTTSWSA-N |
| XLogP | 1.48 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.18 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|