C20H22N2O3 — CID 174961315
4-hydroxy-3-methyl-N-(methylideneamino)-1-benzofuran-5-carboxamide;1,3,5-trimethylbenzene (PubChem CID 174961315) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 4-hydroxy-3-methyl-N-(methylideneamino)-1-benzofuran-5-carboxamide;1,3,5-trimethylbenzene.
| Compound Name | 4-hydroxy-3-methyl-N-(methylideneamino)-1-benzofuran-5-carboxamide;1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 174961315 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 4-hydroxy-3-methyl-N-(methylideneamino)-1-benzofuran-5-carboxamide;1,3,5-trimethylbenzene |
| SMILES | C=NNC(=O)c1ccc2occ(C)c2c1O.Cc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C11H10N2O3.C9H12/c1-6-5-16-8-4-3-7(10(14)9(6)8)11(15)13-12-2;1-7-4-8(2)6-9(3)5-7/h3-5,14H,2H2,1H3,(H,13,15);4-6H,1-3H3 |
| InChIKey | ZKUHBAGNVVBPBH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 74.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|